C18H26N2O — CID 133064609
3-(dimethylamino)-1-(2,2,4,6-tetramethyl-3,4-dihydro-1H-quinolin-7-yl)prop-2-en-1-one (PubChem CID 133064609) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-(dimethylamino)-1-(2,2,4,6-tetramethyl-3,4-dihydro-1H-quinolin-7-yl)prop-2-en-1-one.
| Compound Name | 3-(dimethylamino)-1-(2,2,4,6-tetramethyl-3,4-dihydro-1H-quinolin-7-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 133064609 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-(dimethylamino)-1-(2,2,4,6-tetramethyl-3,4-dihydro-1H-quinolin-7-yl)prop-2-en-1-one |
| SMILES | Cc1cc2c(cc1C(=O)C=CN(C)C)NC(C)(C)CC2C |
| InChI | InChI=1S/C18H26N2O/c1-12-9-14-13(2)11-18(3,4)19-16(14)10-15(12)17(21)7-8-20(5)6/h7-10,13,19H,11H2,1-6H3 |
| InChIKey | GYHLZLLIKPLNDU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|