C4H10O3 — CID 133064662
(2S,3S)-3-hydroperoxybutan-2-ol (PubChem CID 133064662) has the molecular formula C4H10O3 and a molecular weight of 106.12 g/mol. Its IUPAC name is (2S,3S)-3-hydroperoxybutan-2-ol.
| Compound Name | (2S,3S)-3-hydroperoxybutan-2-ol |
|---|---|
| PubChem CID | 133064662 |
| Molecular Formula | C4H10O3 |
| Molecular Weight | 106.12 g/mol |
| Exact Mass | 106.06 |
| IUPAC Name | (2S,3S)-3-hydroperoxybutan-2-ol |
| SMILES | C[C@H](O)[C@H](C)OO |
| InChI | InChI=1S/C4H10O3/c1-3(5)4(2)7-6/h3-6H,1-2H3/t3-,4-/m0/s1 |
| InChIKey | VRQPOZSYDWHVQK-IMJSIDKUSA-N |
| XLogP | 0.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 106.12 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|