About deuterium monohydride;3-methoxybutan-2-ol;phosphane
deuterium monohydride;3-methoxybutan-2-ol;phosphane (PubChem CID 157416424) has the molecular formula C5H17O2P
and a molecular weight of 141.17 g/mol. Its IUPAC name is deuterium monohydride;3-methoxybutan-2-ol;phosphane.
Molecular Properties
| Compound Name | deuterium monohydride;3-methoxybutan-2-ol;phosphane |
| PubChem CID | 157416424 |
| Molecular Formula | C5H17O2P |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | deuterium monohydride;3-methoxybutan-2-ol;phosphane |
| SMILES | COC(C)C(C)O.P.[H][2H] |
| InChI | InChI=1S/C5H12O2.H3P.H2/c1-4(6)5(2)7-3;;/h4-6H,1-3H3;1H3;1H/i;;1+1 |
| InChIKey | BOXAHEVUAWKGHQ-FCHARDOESA-N |
| XLogP | 0.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze deuterium monohydride;3-methoxybutan-2-ol;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterium monohydride;3-methoxybutan-2-ol;phosphane?
The IUPAC name of deuterium monohydride;3-methoxybutan-2-ol;phosphane (CID 157416424) is deuterium monohydride;3-methoxybutan-2-ol;phosphane.
What is the SMILES notation for deuterium monohydride;3-methoxybutan-2-ol;phosphane?
The canonical SMILES for deuterium monohydride;3-methoxybutan-2-ol;phosphane is COC(C)C(C)O.P.[H][2H].
What is the InChIKey of deuterium monohydride;3-methoxybutan-2-ol;phosphane?
The InChIKey is BOXAHEVUAWKGHQ-FCHARDOESA-N. The full InChI is InChI=1S/C5H12O2.H3P.H2/c1-4(6)5(2)7-3;;/h4-6H,1-3H3;1H3;1H/i;;1+1.
What are the key properties of deuterium monohydride;3-methoxybutan-2-ol;phosphane?
deuterium monohydride;3-methoxybutan-2-ol;phosphane has a molecular weight of 141.17 g/mol, XLogP of 0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for deuterium monohydride;3-methoxybutan-2-ol;phosphane is sourced from PubChem (CID 157416424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).