C35H40N2O3Te — CID 133064691
4-[3-[4-(dimethylamino)phenyl]-2-(4-methoxyphenoxy)-2-(4-methoxyphenyl)telluran-3-yl]-N,N-dimethylaniline (PubChem CID 133064691) has the molecular formula C35H40N2O3Te and a molecular weight of 664.32 g/mol. Its IUPAC name is 4-[3-[4-(dimethylamino)phenyl]-2-(4-methoxyphenoxy)-2-(4-methoxyphenyl)telluran-3-yl]-N,N-dimethylaniline.
| Compound Name | 4-[3-[4-(dimethylamino)phenyl]-2-(4-methoxyphenoxy)-2-(4-methoxyphenyl)telluran-3-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 133064691 |
| Molecular Formula | C35H40N2O3Te |
| Molecular Weight | 664.32 g/mol |
| Exact Mass | 666.21 |
| IUPAC Name | 4-[3-[4-(dimethylamino)phenyl]-2-(4-methoxyphenoxy)-2-(4-methoxyphenyl)telluran-3-yl]-N,N-dimethylaniline |
| SMILES | COc1ccc(OC2(c3ccc(OC)cc3)[Te]CCCC2(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C35H40N2O3Te/c1-36(2)29-14-8-26(9-15-29)34(27-10-16-30(17-11-27)37(3)4)24-7-25-41-35(34,28-12-18-31(38-5)19-13-28)40-33-22-20-32(39-6)21-23-33/h8-23H,7,24-25H2,1-6H3 |
| InChIKey | ZYXHSTZWCJHJBH-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.32 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|