C43H44F6N2O2 — CID 139753032
4-[4-[2-[4-[4-[bis(2-methylprop-2-enyl)amino]phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-N,N-bis(2-methylprop-2-enyl)aniline (PubChem CID 139753032) has the molecular formula C43H44F6N2O2 and a molecular weight of 734.82 g/mol. Its IUPAC name is 4-[4-[2-[4-[4-[bis(2-methylprop-2-enyl)amino]phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-N,N-bis(2-methylprop-2-enyl)aniline.
| Compound Name | 4-[4-[2-[4-[4-[bis(2-methylprop-2-enyl)amino]phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-N,N-bis(2-methylprop-2-enyl)aniline |
|---|---|
| PubChem CID | 139753032 |
| Molecular Formula | C43H44F6N2O2 |
| Molecular Weight | 734.82 g/mol |
| Exact Mass | 734.33 |
| IUPAC Name | 4-[4-[2-[4-[4-[bis(2-methylprop-2-enyl)amino]phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-N,N-bis(2-methylprop-2-enyl)aniline |
| SMILES | C=C(C)CN(CC(=C)C)c1ccc(Oc2ccc(C(c3ccc(Oc4ccc(N(CC(=C)C)CC(=C)C)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C43H44F6N2O2/c1-29(2)25-50(26-30(3)4)35-13-21-39(22-14-35)52-37-17-9-33(10-18-37)41(42(44,45)46,43(47,48)49)34-11-19-38(20-12-34)53-40-23-15-36(16-24-40)51(27-31(5)6)28-32(7)8/h9-24H,1,3,5,7,25-28H2,2,4,6,8H3 |
| InChIKey | CEYJQMVVQFHYKS-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.82 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|