C26H20F10O — CID 59850430
1-butan-2-yl-2,3,5,6-tetrafluoro-4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenoxy]benzene (PubChem CID 59850430) has the molecular formula C26H20F10O and a molecular weight of 538.43 g/mol. Its IUPAC name is 1-butan-2-yl-2,3,5,6-tetrafluoro-4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenoxy]benzene.
| Compound Name | 1-butan-2-yl-2,3,5,6-tetrafluoro-4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenoxy]benzene |
|---|---|
| PubChem CID | 59850430 |
| Molecular Formula | C26H20F10O |
| Molecular Weight | 538.43 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 1-butan-2-yl-2,3,5,6-tetrafluoro-4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenoxy]benzene |
| SMILES | CCC(C)c1c(F)c(F)c(Oc2ccc(C(c3ccc(C)cc3)(C(F)(F)F)C(F)(F)F)cc2)c(F)c1F |
| InChI | InChI=1S/C26H20F10O/c1-4-14(3)18-19(27)21(29)23(22(30)20(18)28)37-17-11-9-16(10-12-17)24(25(31,32)33,26(34,35)36)15-7-5-13(2)6-8-15/h5-12,14H,4H2,1-3H3 |
| InChIKey | ULSFJRHSDIZVOP-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.43 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|