C21H26N2O3 — CID 133065665
(1S,15R,18S,19R,20S)-19-methoxycarbonyl-3,11,12,13,14,15,16,17,18,19,20,21-dodecahydro-1H-yohimban-13-ium-18-olate (PubChem CID 133065665) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is (1S,15R,18S,19R,20S)-19-methoxycarbonyl-3,11,12,13,14,15,16,17,18,19,20,21-dodecahydro-1H-yohimban-13-ium-18-olate.
| Compound Name | (1S,15R,18S,19R,20S)-19-methoxycarbonyl-3,11,12,13,14,15,16,17,18,19,20,21-dodecahydro-1H-yohimban-13-ium-18-olate |
|---|---|
| PubChem CID | 133065665 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (1S,15R,18S,19R,20S)-19-methoxycarbonyl-3,11,12,13,14,15,16,17,18,19,20,21-dodecahydro-1H-yohimban-13-ium-18-olate |
| SMILES | COC(=O)[C@@H]1[C@H]2C[C@H]3c4[nH]c5ccccc5c4CC[NH+]3C[C@@H]2CC[C@@H]1[O-] |
| InChI | InChI=1S/C21H25N2O3/c1-26-21(25)19-15-10-17-20-14(13-4-2-3-5-16(13)22-20)8-9-23(17)11-12(15)6-7-18(19)24/h2-5,12,15,17-19,22H,6-11H2,1H3/q-1/p+1/t12-,15-,17-,18-,19+/m0/s1 |
| InChIKey | QVDHHVASSXBMRV-SCYLSFHTSA-O |
| XLogP | 0.60 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|