C35H43N5O4 — CID 133070634
5-[2-acetyl-6-[(2-ethoxyphenyl)methyl]-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-triene-9-carbonyl]-1,3-diethylbenzimidazol-2-one (PubChem CID 133070634) has the molecular formula C35H43N5O4 and a molecular weight of 597.76 g/mol. Its IUPAC name is 5-[2-acetyl-6-[(2-ethoxyphenyl)methyl]-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-triene-9-carbonyl]-1,3-diethylbenzimidazol-2-one.
| Compound Name | 5-[2-acetyl-6-[(2-ethoxyphenyl)methyl]-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-triene-9-carbonyl]-1,3-diethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 133070634 |
| Molecular Formula | C35H43N5O4 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.33 |
| IUPAC Name | 5-[2-acetyl-6-[(2-ethoxyphenyl)methyl]-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-triene-9-carbonyl]-1,3-diethylbenzimidazol-2-one |
| SMILES | CCOc1ccccc1CN1CCCN(C(C)=O)c2ccccc2CN(C(=O)c2ccc3c(c2)n(CC)c(=O)n3CC)CC1 |
| InChI | InChI=1S/C35H43N5O4/c1-5-38-31-18-17-27(23-32(31)39(6-2)35(38)43)34(42)37-22-21-36(24-29-14-9-11-16-33(29)44-7-3)19-12-20-40(26(4)41)30-15-10-8-13-28(30)25-37/h8-11,13-18,23H,5-7,12,19-22,24-25H2,1-4H3 |
| InChIKey | KKUJNUDLYCSOIF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 80.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |