C27H33FN2O6 — CID 133073672
(9R,10S)-1'-[3-(3-fluorophenoxy)propanoyl]-9,10-dihydroxyspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one (PubChem CID 133073672) has the molecular formula C27H33FN2O6 and a molecular weight of 500.57 g/mol. Its IUPAC name is (9R,10S)-1'-[3-(3-fluorophenoxy)propanoyl]-9,10-dihydroxyspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one.
| Compound Name | (9R,10S)-1'-[3-(3-fluorophenoxy)propanoyl]-9,10-dihydroxyspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 133073672 |
| Molecular Formula | C27H33FN2O6 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (9R,10S)-1'-[3-(3-fluorophenoxy)propanoyl]-9,10-dihydroxyspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one |
| SMILES | O=C1COc2ccccc2C[C@H](O)[C@H](O)CC2(CCN(C(=O)CCOc3cccc(F)c3)CC2)CN1 |
| InChI | InChI=1S/C27H33FN2O6/c28-20-5-3-6-21(15-20)35-13-8-26(34)30-11-9-27(10-12-30)16-23(32)22(31)14-19-4-1-2-7-24(19)36-17-25(33)29-18-27/h1-7,15,22-23,31-32H,8-14,16-18H2,(H,29,33)/t22-,23+/m0/s1 |
| InChIKey | MQECZBLPHOALLB-XZOQPEGZSA-N |
| XLogP | 2.07 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |