C31H35N5O5 — CID 133074917
(4R,11S)-4-benzyl-7,7-dimethyl-6,9,13-trioxo-N-(2-pyridin-2-ylethyl)-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133074917) has the molecular formula C31H35N5O5 and a molecular weight of 557.65 g/mol. Its IUPAC name is (4R,11S)-4-benzyl-7,7-dimethyl-6,9,13-trioxo-N-(2-pyridin-2-ylethyl)-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (4R,11S)-4-benzyl-7,7-dimethyl-6,9,13-trioxo-N-(2-pyridin-2-ylethyl)-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133074917 |
| Molecular Formula | C31H35N5O5 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | (4R,11S)-4-benzyl-7,7-dimethyl-6,9,13-trioxo-N-(2-pyridin-2-ylethyl)-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | CC1(C)NC(=O)C[C@@H](C(=O)NCCc2ccccn2)NC(=O)c2ccccc2OC[C@@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C31H35N5O5/c1-31(2)30(40)34-23(18-21-10-4-3-5-11-21)20-41-26-14-7-6-13-24(26)28(38)35-25(19-27(37)36-31)29(39)33-17-15-22-12-8-9-16-32-22/h3-14,16,23,25H,15,17-20H2,1-2H3,(H,33,39)(H,34,40)(H,35,38)(H,36,37)/t23-,25+/m1/s1 |
| InChIKey | AQFVDZVMNKVJLP-NOZRDPDXSA-N |
| XLogP | 1.94 |
| TPSA | 138.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |