C11H15ClO — CID 13307910
3-chloro-2,2-dimethyl-4a,5,6,8a-tetrahydrochromene (PubChem CID 13307910) has the molecular formula C11H15ClO and a molecular weight of 198.69 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-4a,5,6,8a-tetrahydrochromene.
| Compound Name | 3-chloro-2,2-dimethyl-4a,5,6,8a-tetrahydrochromene |
|---|---|
| PubChem CID | 13307910 |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.69 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 3-chloro-2,2-dimethyl-4a,5,6,8a-tetrahydrochromene |
| SMILES | CC1(C)OC2C=CCCC2C=C1Cl |
| InChI | InChI=1S/C11H15ClO/c1-11(2)10(12)7-8-5-3-4-6-9(8)13-11/h4,6-9H,3,5H2,1-2H3 |
| InChIKey | JLIDLOLBQWKALV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.69 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|