C6H8O3 — CID 102201787
3a,4,5,7a-tetrahydrobenzotrioxole (PubChem CID 102201787) has the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. Its IUPAC name is 3a,4,5,7a-tetrahydrobenzotrioxole.
| Compound Name | 3a,4,5,7a-tetrahydrobenzotrioxole |
|---|---|
| PubChem CID | 102201787 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 3a,4,5,7a-tetrahydrobenzotrioxole |
| SMILES | C1=CC2OOOC2CC1 |
| InChI | InChI=1S/C6H8O3/c1-2-4-6-5(3-1)7-9-8-6/h1,3,5-6H,2,4H2 |
| InChIKey | AIWOKOXOTHZQJK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|