C21H31NO5Si — CID 133081985
1-O-benzyl 5-O-methyl 4-hydroxy-3-triethylsilyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (PubChem CID 133081985) has the molecular formula C21H31NO5Si and a molecular weight of 405.57 g/mol. Its IUPAC name is 1-O-benzyl 5-O-methyl 4-hydroxy-3-triethylsilyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
| Compound Name | 1-O-benzyl 5-O-methyl 4-hydroxy-3-triethylsilyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 133081985 |
| Molecular Formula | C21H31NO5Si |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 1-O-benzyl 5-O-methyl 4-hydroxy-3-triethylsilyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| SMILES | CC[Si](CC)(CC)C1CN(C(=O)OCc2ccccc2)CC(C(=O)OC)=C1O |
| InChI | InChI=1S/C21H31NO5Si/c1-5-28(6-2,7-3)18-14-22(13-17(19(18)23)20(24)26-4)21(25)27-15-16-11-9-8-10-12-16/h8-12,18,23H,5-7,13-15H2,1-4H3 |
| InChIKey | FTEGVMXOEWSWBB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|