C16H16F3NO7S — CID 58977818
1-O-benzyl 5-O-methyl 4-(trifluoromethylperoxysulfanyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (PubChem CID 58977818) has the molecular formula C16H16F3NO7S and a molecular weight of 423.37 g/mol. Its IUPAC name is 1-O-benzyl 5-O-methyl 4-(trifluoromethylperoxysulfanyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
| Compound Name | 1-O-benzyl 5-O-methyl 4-(trifluoromethylperoxysulfanyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 58977818 |
| Molecular Formula | C16H16F3NO7S |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 1-O-benzyl 5-O-methyl 4-(trifluoromethylperoxysulfanyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| SMILES | COC(=O)C1=C(OSOOC(F)(F)F)CCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C16H16F3NO7S/c1-23-14(21)12-9-20(15(22)24-10-11-5-3-2-4-6-11)8-7-13(12)25-28-27-26-16(17,18)19/h2-6H,7-10H2,1H3 |
| InChIKey | XGIMCYHFWFQSIR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|