C22H30F3NO7SSi — CID 133082007
1-O-benzyl 5-O-methyl 3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (PubChem CID 133082007) has the molecular formula C22H30F3NO7SSi and a molecular weight of 537.63 g/mol. Its IUPAC name is 1-O-benzyl 5-O-methyl 3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
| Compound Name | 1-O-benzyl 5-O-methyl 3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 133082007 |
| Molecular Formula | C22H30F3NO7SSi |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 1-O-benzyl 5-O-methyl 3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| SMILES | CC[Si](CC)(CC)C1CN(C(=O)OCc2ccccc2)CC(C(=O)OC)=C1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C22H30F3NO7SSi/c1-5-35(6-2,7-3)18-14-26(21(28)32-15-16-11-9-8-10-12-16)13-17(20(27)31-4)19(18)33-34(29,30)22(23,24)25/h8-12,18H,5-7,13-15H2,1-4H3 |
| InChIKey | QCRQHHOOZYNEAZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|