C20H26F3NO5S — CID 134931934
benzyl (2S,6R)-2,6-dipropyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 134931934) has the molecular formula C20H26F3NO5S and a molecular weight of 449.49 g/mol. Its IUPAC name is benzyl (2S,6R)-2,6-dipropyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | benzyl (2S,6R)-2,6-dipropyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 134931934 |
| Molecular Formula | C20H26F3NO5S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | benzyl (2S,6R)-2,6-dipropyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCC[C@H]1CC(OS(=O)(=O)C(F)(F)F)=C[C@@H](CCC)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H26F3NO5S/c1-3-8-16-12-18(29-30(26,27)20(21,22)23)13-17(9-4-2)24(16)19(25)28-14-15-10-6-5-7-11-15/h5-7,10-12,16-17H,3-4,8-9,13-14H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | DQASGOZAYVYFCP-SJORKVTESA-N |
| XLogP | 5.12 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|