C21H30F3NO5SSi — CID 133082017
benzyl 3-methyl-3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carboxylate (PubChem CID 133082017) has the molecular formula C21H30F3NO5SSi and a molecular weight of 493.62 g/mol. Its IUPAC name is benzyl 3-methyl-3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carboxylate.
| Compound Name | benzyl 3-methyl-3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 133082017 |
| Molecular Formula | C21H30F3NO5SSi |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | benzyl 3-methyl-3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carboxylate |
| SMILES | CC[Si](CC)(CC)C1(C)CN(C(=O)OCc2ccccc2)CC=C1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C21H30F3NO5SSi/c1-5-32(6-2,7-3)20(4)16-25(19(26)29-15-17-11-9-8-10-12-17)14-13-18(20)30-31(27,28)21(22,23)24/h8-13H,5-7,14-16H2,1-4H3 |
| InChIKey | WCJOXHLUTNPZDM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|