C23H32F3NO7SSi — CID 162408645
(4-methoxycarbonylphenyl)methyl 3-methyl-3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carboxylate (PubChem CID 162408645) has the molecular formula C23H32F3NO7SSi and a molecular weight of 551.66 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl)methyl 3-methyl-3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl)methyl 3-methyl-3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 162408645 |
| Molecular Formula | C23H32F3NO7SSi |
| Molecular Weight | 551.66 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | (4-methoxycarbonylphenyl)methyl 3-methyl-3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carboxylate |
| SMILES | CC[Si](CC)(CC)C1(C)CN(C(=O)OCc2ccc(C(=O)OC)cc2)CC=C1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C23H32F3NO7SSi/c1-6-36(7-2,8-3)22(4)16-27(14-13-19(22)34-35(30,31)23(24,25)26)21(29)33-15-17-9-11-18(12-10-17)20(28)32-5/h9-13H,6-8,14-16H2,1-5H3 |
| InChIKey | XDHIYSHQMDIQPJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.66 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|