C20H28F3NO5SSi — CID 133081987
benzyl 3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 133081987) has the molecular formula C20H28F3NO5SSi and a molecular weight of 479.59 g/mol. Its IUPAC name is benzyl 3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | benzyl 3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 133081987 |
| Molecular Formula | C20H28F3NO5SSi |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | benzyl 3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC[Si](CC)(CC)C1CN(C(=O)OCc2ccccc2)CC=C1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H28F3NO5SSi/c1-4-31(5-2,6-3)18-14-24(19(25)28-15-16-10-8-7-9-11-16)13-12-17(18)29-30(26,27)20(21,22)23/h7-12,18H,4-6,13-15H2,1-3H3 |
| InChIKey | VIQOOHVDSMQBPT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|