C22H33NO5Si — CID 133081995
1-O-benzyl 3-O-methyl 4-hydroxy-5-methyl-5-triethylsilyl-2,6-dihydropyridine-1,3-dicarboxylate (PubChem CID 133081995) has the molecular formula C22H33NO5Si and a molecular weight of 419.59 g/mol. Its IUPAC name is 1-O-benzyl 3-O-methyl 4-hydroxy-5-methyl-5-triethylsilyl-2,6-dihydropyridine-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-methyl 4-hydroxy-5-methyl-5-triethylsilyl-2,6-dihydropyridine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 133081995 |
| Molecular Formula | C22H33NO5Si |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 1-O-benzyl 3-O-methyl 4-hydroxy-5-methyl-5-triethylsilyl-2,6-dihydropyridine-1,3-dicarboxylate |
| SMILES | CC[Si](CC)(CC)C1(C)CN(C(=O)OCc2ccccc2)CC(C(=O)OC)=C1O |
| InChI | InChI=1S/C22H33NO5Si/c1-6-29(7-2,8-3)22(4)16-23(14-18(19(22)24)20(25)27-5)21(26)28-15-17-12-10-9-11-13-17/h9-13,24H,6-8,14-16H2,1-5H3 |
| InChIKey | VMEVNZNVODFZOG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|