C8H8F3N3O2 — CID 133085848
6-amino-3-(aminomethyl)-4-(trifluoromethoxy)pyridine-2-carbaldehyde (PubChem CID 133085848) has the molecular formula C8H8F3N3O2 and a molecular weight of 235.16 g/mol. Its IUPAC name is 6-amino-3-(aminomethyl)-4-(trifluoromethoxy)pyridine-2-carbaldehyde.
| Compound Name | 6-amino-3-(aminomethyl)-4-(trifluoromethoxy)pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 133085848 |
| Molecular Formula | C8H8F3N3O2 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 6-amino-3-(aminomethyl)-4-(trifluoromethoxy)pyridine-2-carbaldehyde |
| SMILES | NCc1c(OC(F)(F)F)cc(N)nc1C=O |
| InChI | InChI=1S/C8H8F3N3O2/c9-8(10,11)16-6-1-7(13)14-5(3-15)4(6)2-12/h1,3H,2,12H2,(H2,13,14) |
| InChIKey | HAKYTWFPVQMRJO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|