2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid

C13H8Cl3NO2 — CID 133088475

IUPAC2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid
SMILESO=C(O)Cc1cc(-c2ccc(Cl)c(Cl)c2)ncc1Cl
InChIInChI=1S/C13H8Cl3NO2/c14-9-2-1-7(3-10(9)15)12-4-8(5-13(18)19)11(16)6-17-12/h1-4,6H,5H2,(H,18,19)
InChIKeyZDRQJNUQBVMXRD-UHFFFAOYSA-N
MW316.57 g/mol
LogP4.34
Rot. Bonds3

About 2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid

2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid (PubChem CID 133088475) has the molecular formula C13H8Cl3NO2 and a molecular weight of 316.57 g/mol. Its IUPAC name is 2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid.

Molecular Properties

Compound Name2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid
PubChem CID133088475
Molecular FormulaC13H8Cl3NO2
Molecular Weight316.57 g/mol
Exact Mass314.96
IUPAC Name2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid
SMILESO=C(O)Cc1cc(-c2ccc(Cl)c(Cl)c2)ncc1Cl
InChIInChI=1S/C13H8Cl3NO2/c14-9-2-1-7(3-10(9)15)12-4-8(5-13(18)19)11(16)6-17-12/h1-4,6H,5H2,(H,18,19)
InChIKeyZDRQJNUQBVMXRD-UHFFFAOYSA-N
XLogP4.34
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.57
LogP ≤ 54.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid?
The IUPAC name of 2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid (CID 133088475) is 2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid.
What is the SMILES notation for 2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid?
The canonical SMILES for 2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid is O=C(O)Cc1cc(-c2ccc(Cl)c(Cl)c2)ncc1Cl.
What is the InChIKey of 2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid?
The InChIKey is ZDRQJNUQBVMXRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl3NO2/c14-9-2-1-7(3-10(9)15)12-4-8(5-13(18)19)11(16)6-17-12/h1-4,6H,5H2,(H,18,19).
What are the key properties of 2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid?
2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid has a molecular weight of 316.57 g/mol, XLogP of 4.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-chloro-2-(3,4-dichlorophenyl)-4-pyridinyl]acetic acid is sourced from PubChem (CID 133088475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).