C12H9Cl2NO2 — CID 133092837
5-(3,4-dichlorophenyl)-4-(hydroxymethyl)-1H-pyridin-2-one (PubChem CID 133092837) has the molecular formula C12H9Cl2NO2 and a molecular weight of 270.12 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-4-(hydroxymethyl)-1H-pyridin-2-one.
| Compound Name | 5-(3,4-dichlorophenyl)-4-(hydroxymethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 133092837 |
| Molecular Formula | C12H9Cl2NO2 |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-4-(hydroxymethyl)-1H-pyridin-2-one |
| SMILES | O=c1cc(CO)c(-c2ccc(Cl)c(Cl)c2)c[nH]1 |
| InChI | InChI=1S/C12H9Cl2NO2/c13-10-2-1-7(3-11(10)14)9-5-15-12(17)4-8(9)6-16/h1-5,16H,6H2,(H,15,17) |
| InChIKey | WBVKXDYDSLFMOV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |