C7H3F6NS — CID 133095140
3,4-bis(trifluoromethyl)-1H-pyridine-2-thione (PubChem CID 133095140) has the molecular formula C7H3F6NS and a molecular weight of 247.16 g/mol. Its IUPAC name is 3,4-bis(trifluoromethyl)-1H-pyridine-2-thione.
| Compound Name | 3,4-bis(trifluoromethyl)-1H-pyridine-2-thione |
|---|---|
| PubChem CID | 133095140 |
| Molecular Formula | C7H3F6NS |
| Molecular Weight | 247.16 g/mol |
| Exact Mass | 246.99 |
| IUPAC Name | 3,4-bis(trifluoromethyl)-1H-pyridine-2-thione |
| SMILES | FC(F)(F)c1cc[nH]c(=S)c1C(F)(F)F |
| InChI | InChI=1S/C7H3F6NS/c8-6(9,10)3-1-2-14-5(15)4(3)7(11,12)13/h1-2H,(H,14,15) |
| InChIKey | NXKDLGROUFLXMP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.16 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|