C10H5F6N — CID 175260165
5,6-bis(trifluoromethyl)-1H-indole (PubChem CID 175260165) has the molecular formula C10H5F6N and a molecular weight of 253.15 g/mol. Its IUPAC name is 5,6-bis(trifluoromethyl)-1H-indole.
| Compound Name | 5,6-bis(trifluoromethyl)-1H-indole |
|---|---|
| PubChem CID | 175260165 |
| Molecular Formula | C10H5F6N |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 5,6-bis(trifluoromethyl)-1H-indole |
| SMILES | FC(F)(F)c1cc2cc[nH]c2cc1C(F)(F)F |
| InChI | InChI=1S/C10H5F6N/c11-9(12,13)6-3-5-1-2-17-8(5)4-7(6)10(14,15)16/h1-4,17H |
| InChIKey | ATGJTBVDJYSNKV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |