C7H4F3N3O3S — CID 133096320
6-cyano-2-(trifluoromethoxy)pyridine-3-sulfonamide (PubChem CID 133096320) has the molecular formula C7H4F3N3O3S and a molecular weight of 267.19 g/mol. Its IUPAC name is 6-cyano-2-(trifluoromethoxy)pyridine-3-sulfonamide.
| Compound Name | 6-cyano-2-(trifluoromethoxy)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133096320 |
| Molecular Formula | C7H4F3N3O3S |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 6-cyano-2-(trifluoromethoxy)pyridine-3-sulfonamide |
| SMILES | N#Cc1ccc(S(N)(=O)=O)c(OC(F)(F)F)n1 |
| InChI | InChI=1S/C7H4F3N3O3S/c8-7(9,10)16-6-5(17(12,14)15)2-1-4(3-11)13-6/h1-2H,(H2,12,14,15) |
| InChIKey | LMULLEOGKSJWEK-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |