C11H12F3NO3 — CID 133096845
ethyl 2-[5-methoxy-2-(trifluoromethyl)-3-pyridinyl]acetate (PubChem CID 133096845) has the molecular formula C11H12F3NO3 and a molecular weight of 263.21 g/mol. Its IUPAC name is ethyl 2-[5-methoxy-2-(trifluoromethyl)-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-methoxy-2-(trifluoromethyl)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 133096845 |
| Molecular Formula | C11H12F3NO3 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | ethyl 2-[5-methoxy-2-(trifluoromethyl)-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cc(OC)cnc1C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO3/c1-3-18-9(16)5-7-4-8(17-2)6-15-10(7)11(12,13)14/h4,6H,3,5H2,1-2H3 |
| InChIKey | LNSIPMUABLZBIP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |