C21H29N3O2 — CID 133111217
1-N'-[(3S,4R)-1-[(E)-3-phenylprop-2-enyl]-4-propan-2-ylpyrrolidin-3-yl]cyclopropane-1,1-dicarboxamide (PubChem CID 133111217) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-N'-[(3S,4R)-1-[(E)-3-phenylprop-2-enyl]-4-propan-2-ylpyrrolidin-3-yl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[(3S,4R)-1-[(E)-3-phenylprop-2-enyl]-4-propan-2-ylpyrrolidin-3-yl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 133111217 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 1-N'-[(3S,4R)-1-[(E)-3-phenylprop-2-enyl]-4-propan-2-ylpyrrolidin-3-yl]cyclopropane-1,1-dicarboxamide |
| SMILES | CC(C)[C@@H]1CN(C/C=C/c2ccccc2)C[C@H]1NC(=O)C1(C(N)=O)CC1 |
| InChI | InChI=1S/C21H29N3O2/c1-15(2)17-13-24(12-6-9-16-7-4-3-5-8-16)14-18(17)23-20(26)21(10-11-21)19(22)25/h3-9,15,17-18H,10-14H2,1-2H3,(H2,22,25)(H,23,26)/b9-6+/t17-,18+/m0/s1 |
| InChIKey | BVSGDXXRNFEJPD-WMHOYKDJSA-N |
| XLogP | 2.04 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|