C22H33N3O2 — CID 133112648
N-[(1R,2S)-2-(cycloheptylamino)cyclobutyl]-2-morpholin-4-ylbenzamide (PubChem CID 133112648) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-[(1R,2S)-2-(cycloheptylamino)cyclobutyl]-2-morpholin-4-ylbenzamide.
| Compound Name | N-[(1R,2S)-2-(cycloheptylamino)cyclobutyl]-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 133112648 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-[(1R,2S)-2-(cycloheptylamino)cyclobutyl]-2-morpholin-4-ylbenzamide |
| SMILES | O=C(N[C@@H]1CC[C@@H]1NC1CCCCCC1)c1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C22H33N3O2/c26-22(18-9-5-6-10-21(18)25-13-15-27-16-14-25)24-20-12-11-19(20)23-17-7-3-1-2-4-8-17/h5-6,9-10,17,19-20,23H,1-4,7-8,11-16H2,(H,24,26)/t19-,20+/m0/s1 |
| InChIKey | LDSCOIPTKJJGFU-VQTJNVASSA-N |
| XLogP | 3.10 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |