C16H22N2O4S — CID 91766122
N-(1,1-dioxothian-4-yl)-2-morpholin-4-ylbenzamide (PubChem CID 91766122) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-2-morpholin-4-ylbenzamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 91766122 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-2-morpholin-4-ylbenzamide |
| SMILES | O=C(NC1CCS(=O)(=O)CC1)c1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C16H22N2O4S/c19-16(17-13-5-11-23(20,21)12-6-13)14-3-1-2-4-15(14)18-7-9-22-10-8-18/h1-4,13H,5-12H2,(H,17,19) |
| InChIKey | YRINFBVBADFJIN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |