C20H28N2O3 — CID 125165608
2-morpholin-4-yl-N-[(3S)-1-oxaspiro[4.5]decan-3-yl]benzamide (PubChem CID 125165608) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-[(3S)-1-oxaspiro[4.5]decan-3-yl]benzamide.
| Compound Name | 2-morpholin-4-yl-N-[(3S)-1-oxaspiro[4.5]decan-3-yl]benzamide |
|---|---|
| PubChem CID | 125165608 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2-morpholin-4-yl-N-[(3S)-1-oxaspiro[4.5]decan-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1COC2(CCCCC2)C1)c1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C20H28N2O3/c23-19(21-16-14-20(25-15-16)8-4-1-5-9-20)17-6-2-3-7-18(17)22-10-12-24-13-11-22/h2-3,6-7,16H,1,4-5,8-15H2,(H,21,23)/t16-/m0/s1 |
| InChIKey | ABPUKRYFDGIBCP-INIZCTEOSA-N |
| XLogP | 2.74 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |