C18H24N2O5 — CID 133114981
(4aR,8aS)-6-[[2-(carboxymethoxy)phenyl]methyl]-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a-carboxylic acid (PubChem CID 133114981) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is (4aR,8aS)-6-[[2-(carboxymethoxy)phenyl]methyl]-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a-carboxylic acid.
| Compound Name | (4aR,8aS)-6-[[2-(carboxymethoxy)phenyl]methyl]-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a-carboxylic acid |
|---|---|
| PubChem CID | 133114981 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (4aR,8aS)-6-[[2-(carboxymethoxy)phenyl]methyl]-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a-carboxylic acid |
| SMILES | O=C(O)COc1ccccc1CN1CC[C@@H]2NCCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C18H24N2O5/c21-16(22)11-25-14-5-2-1-4-13(14)10-20-9-6-15-18(12-20,17(23)24)7-3-8-19-15/h1-2,4-5,15,19H,3,6-12H2,(H,21,22)(H,23,24)/t15-,18+/m0/s1 |
| InChIKey | OAGVFHWKQLVKPF-MAUKXSAKSA-N |
| XLogP | 1.18 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |