C17H26N2O — CID 133118132
(3R,4R)-1-(2-phenylethyl)-4-piperidin-1-ylpyrrolidin-3-ol (PubChem CID 133118132) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is (3R,4R)-1-(2-phenylethyl)-4-piperidin-1-ylpyrrolidin-3-ol.
| Compound Name | (3R,4R)-1-(2-phenylethyl)-4-piperidin-1-ylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 133118132 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (3R,4R)-1-(2-phenylethyl)-4-piperidin-1-ylpyrrolidin-3-ol |
| SMILES | O[C@@H]1CN(CCc2ccccc2)C[C@H]1N1CCCCC1 |
| InChI | InChI=1S/C17H26N2O/c20-17-14-18(12-9-15-7-3-1-4-8-15)13-16(17)19-10-5-2-6-11-19/h1,3-4,7-8,16-17,20H,2,5-6,9-14H2/t16-,17-/m1/s1 |
| InChIKey | GVELTJKIWOBOOS-IAGOWNOFSA-N |
| XLogP | 1.76 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |