C17H21N5O3S — CID 133121824
(4aR,7aS)-N-(1-methyl-4-phenylpyrazol-5-yl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carboxamide (PubChem CID 133121824) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is (4aR,7aS)-N-(1-methyl-4-phenylpyrazol-5-yl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carboxamide.
| Compound Name | (4aR,7aS)-N-(1-methyl-4-phenylpyrazol-5-yl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 133121824 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (4aR,7aS)-N-(1-methyl-4-phenylpyrazol-5-yl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carboxamide |
| SMILES | Cn1ncc(-c2ccccc2)c1NC(=O)N1CCN[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C17H21N5O3S/c1-21-16(13(9-19-21)12-5-3-2-4-6-12)20-17(23)22-8-7-18-14-10-26(24,25)11-15(14)22/h2-6,9,14-15,18H,7-8,10-11H2,1H3,(H,20,23)/t14-,15+/m1/s1 |
| InChIKey | RJFNBSDJBYHHMG-CABCVRRESA-N |
| XLogP | 0.69 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |