C22H26FN3O2 — CID 133124247
(2-ethyl-4-methyl-1,3-oxazol-5-yl)-[(2S,3S,6S)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone (PubChem CID 133124247) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is (2-ethyl-4-methyl-1,3-oxazol-5-yl)-[(2S,3S,6S)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone.
| Compound Name | (2-ethyl-4-methyl-1,3-oxazol-5-yl)-[(2S,3S,6S)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone |
|---|---|
| PubChem CID | 133124247 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (2-ethyl-4-methyl-1,3-oxazol-5-yl)-[(2S,3S,6S)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone |
| SMILES | CCc1nc(C)c(C(=O)N2C[C@H](c3ccc(F)cc3)[C@H]3[C@@H]2C2CCN3CC2)o1 |
| InChI | InChI=1S/C22H26FN3O2/c1-3-18-24-13(2)21(28-18)22(27)26-12-17(14-4-6-16(23)7-5-14)20-19(26)15-8-10-25(20)11-9-15/h4-7,15,17,19-20H,3,8-12H2,1-2H3/t17-,19+,20+/m1/s1 |
| InChIKey | MIXKOKHRIVATQA-HOJAQTOUSA-N |
| XLogP | 3.39 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |