C20H21FN4O3 — CID 72911878
5-[(2R,3R,6R)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carbonyl]-1H-pyrimidine-2,4-dione (PubChem CID 72911878) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is 5-[(2R,3R,6R)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carbonyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(2R,3R,6R)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carbonyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 72911878 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 5-[(2R,3R,6R)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carbonyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=C(c1c[nH]c(=O)[nH]c1=O)N1C[C@@H](c2ccc(F)cc2)[C@@H]2[C@H]1C1CCN2CC1 |
| InChI | InChI=1S/C20H21FN4O3/c21-13-3-1-11(2-4-13)15-10-25(16-12-5-7-24(8-6-12)17(15)16)19(27)14-9-22-20(28)23-18(14)26/h1-4,9,12,15-17H,5-8,10H2,(H2,22,23,26,28)/t15-,16+,17+/m0/s1 |
| InChIKey | BPUXHSDWEACGHN-GVDBMIGSSA-N |
| XLogP | 0.90 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |