C16H28N4O4S — CID 133131121
1-[(4aS,7aR)-6,6-dioxo-4-(piperidine-1-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-(dimethylamino)ethanone (PubChem CID 133131121) has the molecular formula C16H28N4O4S and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-[(4aS,7aR)-6,6-dioxo-4-(piperidine-1-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-(dimethylamino)ethanone.
| Compound Name | 1-[(4aS,7aR)-6,6-dioxo-4-(piperidine-1-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-(dimethylamino)ethanone |
|---|---|
| PubChem CID | 133131121 |
| Molecular Formula | C16H28N4O4S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-[(4aS,7aR)-6,6-dioxo-4-(piperidine-1-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-(dimethylamino)ethanone |
| SMILES | CN(C)CC(=O)N1CCN(C(=O)N2CCCCC2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C16H28N4O4S/c1-17(2)10-15(21)19-8-9-20(14-12-25(23,24)11-13(14)19)16(22)18-6-4-3-5-7-18/h13-14H,3-12H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | YMQBJZHYXLAFAA-UONOGXRCSA-N |
| XLogP | -0.54 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |