C17H31N3O3S — CID 91940156
1-[(4aS,7aR)-1-(4-methylhex-3-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-(dimethylamino)ethanone (PubChem CID 91940156) has the molecular formula C17H31N3O3S and a molecular weight of 357.52 g/mol. Its IUPAC name is 1-[(4aS,7aR)-1-(4-methylhex-3-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-(dimethylamino)ethanone.
| Compound Name | 1-[(4aS,7aR)-1-(4-methylhex-3-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-(dimethylamino)ethanone |
|---|---|
| PubChem CID | 91940156 |
| Molecular Formula | C17H31N3O3S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-[(4aS,7aR)-1-(4-methylhex-3-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-(dimethylamino)ethanone |
| SMILES | CCC(C)=CCCN1CCN(C(=O)CN(C)C)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C17H31N3O3S/c1-5-14(2)7-6-8-19-9-10-20(17(21)11-18(3)4)16-13-24(22,23)12-15(16)19/h7,15-16H,5-6,8-13H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | BCOCUSHXTQLGLT-JKSUJKDBSA-N |
| XLogP | 0.60 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|