C18H21ClN4O — CID 133135286
[(1R,3S)-3-aminocyclopentyl]-[2-(4-chlorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone (PubChem CID 133135286) has the molecular formula C18H21ClN4O and a molecular weight of 344.85 g/mol. Its IUPAC name is [(1R,3S)-3-aminocyclopentyl]-[2-(4-chlorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone.
| Compound Name | [(1R,3S)-3-aminocyclopentyl]-[2-(4-chlorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 133135286 |
| Molecular Formula | C18H21ClN4O |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [(1R,3S)-3-aminocyclopentyl]-[2-(4-chlorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
| SMILES | N[C@H]1CC[C@@H](C(=O)N2CCc3nc(-c4ccc(Cl)cc4)[nH]c3C2)C1 |
| InChI | InChI=1S/C18H21ClN4O/c19-13-4-1-11(2-5-13)17-21-15-7-8-23(10-16(15)22-17)18(24)12-3-6-14(20)9-12/h1-2,4-5,12,14H,3,6-10,20H2,(H,21,22)/t12-,14+/m1/s1 |
| InChIKey | ABXLBMILKCMIOR-OCCSQVGLSA-N |
| XLogP | 2.74 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |