C13H15N5OS — CID 133136346
[(3aS,6aR)-1-(1,3,4-thiadiazol-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 133136346) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is [(3aS,6aR)-1-(1,3,4-thiadiazol-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [(3aS,6aR)-1-(1,3,4-thiadiazol-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 133136346 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [(3aS,6aR)-1-(1,3,4-thiadiazol-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1ccc[nH]1)N1CC[C@@H]2[C@@H]1CCN2c1nncs1 |
| InChI | InChI=1S/C13H15N5OS/c19-12(9-2-1-5-14-9)17-6-3-11-10(17)4-7-18(11)13-16-15-8-20-13/h1-2,5,8,10-11,14H,3-4,6-7H2/t10-,11+/m0/s1 |
| InChIKey | KTBMPLBVVWDGPA-WDEREUQCSA-N |
| XLogP | 1.36 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |