C20H33N3O2 — CID 133138396
N-[(3S,4R)-4-cyclopropyl-1-[(E)-2-methylbut-2-enyl]pyrrolidin-3-yl]-3-(2-oxopiperidin-1-yl)propanamide (PubChem CID 133138396) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is N-[(3S,4R)-4-cyclopropyl-1-[(E)-2-methylbut-2-enyl]pyrrolidin-3-yl]-3-(2-oxopiperidin-1-yl)propanamide.
| Compound Name | N-[(3S,4R)-4-cyclopropyl-1-[(E)-2-methylbut-2-enyl]pyrrolidin-3-yl]-3-(2-oxopiperidin-1-yl)propanamide |
|---|---|
| PubChem CID | 133138396 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | N-[(3S,4R)-4-cyclopropyl-1-[(E)-2-methylbut-2-enyl]pyrrolidin-3-yl]-3-(2-oxopiperidin-1-yl)propanamide |
| SMILES | C/C=C(\C)CN1C[C@@H](NC(=O)CCN2CCCCC2=O)[C@H](C2CC2)C1 |
| InChI | InChI=1S/C20H33N3O2/c1-3-15(2)12-22-13-17(16-7-8-16)18(14-22)21-19(24)9-11-23-10-5-4-6-20(23)25/h3,16-18H,4-14H2,1-2H3,(H,21,24)/b15-3+/t17-,18+/m0/s1 |
| InChIKey | CBTQSQLGWREDRN-YUTZCPGQSA-N |
| XLogP | 2.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|