C14H20N4O3 — CID 133139400
1-[(4aR,8aR)-6-(5-methyl-1H-pyrazole-3-carbonyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]ethanone (PubChem CID 133139400) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-[(4aR,8aR)-6-(5-methyl-1H-pyrazole-3-carbonyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]ethanone.
| Compound Name | 1-[(4aR,8aR)-6-(5-methyl-1H-pyrazole-3-carbonyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]ethanone |
|---|---|
| PubChem CID | 133139400 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-[(4aR,8aR)-6-(5-methyl-1H-pyrazole-3-carbonyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]ethanone |
| SMILES | CC(=O)N1CCO[C@@H]2CCN(C(=O)c3cc(C)[nH]n3)C[C@H]21 |
| InChI | InChI=1S/C14H20N4O3/c1-9-7-11(16-15-9)14(20)17-4-3-13-12(8-17)18(10(2)19)5-6-21-13/h7,12-13H,3-6,8H2,1-2H3,(H,15,16)/t12-,13-/m1/s1 |
| InChIKey | VHKGAMUIFRZHDX-CHWSQXEVSA-N |
| XLogP | 0.18 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |