C15H23N3O2 — CID 133142696
(4aR,7aR)-6-(ethoxymethyl)-4-(6-methylpyridazin-3-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 133142696) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is (4aR,7aR)-6-(ethoxymethyl)-4-(6-methylpyridazin-3-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aR,7aR)-6-(ethoxymethyl)-4-(6-methylpyridazin-3-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 133142696 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (4aR,7aR)-6-(ethoxymethyl)-4-(6-methylpyridazin-3-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | CCOCC1C[C@@H]2[C@@H](C1)OCCN2c1ccc(C)nn1 |
| InChI | InChI=1S/C15H23N3O2/c1-3-19-10-12-8-13-14(9-12)20-7-6-18(13)15-5-4-11(2)16-17-15/h4-5,12-14H,3,6-10H2,1-2H3/t12?,13-,14-/m1/s1 |
| InChIKey | UCJDXEPFVFCVFE-ILMHWDKJSA-N |
| XLogP | 1.81 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |