C16H27NO4 — CID 134078320
[6-(ethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(oxan-4-yl)methanone (PubChem CID 134078320) has the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. Its IUPAC name is [6-(ethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(oxan-4-yl)methanone.
| Compound Name | [6-(ethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 134078320 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | [6-(ethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(oxan-4-yl)methanone |
| SMILES | CCOCC1CC2OCCN(C(=O)C3CCOCC3)C2C1 |
| InChI | InChI=1S/C16H27NO4/c1-2-19-11-12-9-14-15(10-12)21-8-5-17(14)16(18)13-3-6-20-7-4-13/h12-15H,2-11H2,1H3 |
| InChIKey | HDZYYMQLDMJIPY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |