C13H18N2O3 — CID 133142985
[(8aR)-2,3,4a,5,6,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-1-yl]-(3-methylfuran-2-yl)methanone (PubChem CID 133142985) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is [(8aR)-2,3,4a,5,6,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-1-yl]-(3-methylfuran-2-yl)methanone.
| Compound Name | [(8aR)-2,3,4a,5,6,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-1-yl]-(3-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 133142985 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | [(8aR)-2,3,4a,5,6,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-1-yl]-(3-methylfuran-2-yl)methanone |
| SMILES | Cc1ccoc1C(=O)N1CCOC2CNCC[C@H]21 |
| InChI | InChI=1S/C13H18N2O3/c1-9-3-6-18-12(9)13(16)15-5-7-17-11-8-14-4-2-10(11)15/h3,6,10-11,14H,2,4-5,7-8H2,1H3/t10-,11?/m1/s1 |
| InChIKey | SAVSDOZTYHVYBS-NFJWQWPMSA-N |
| XLogP | 0.79 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |