C18H22N4OS — CID 133143529
[(2R)-2-pyridin-3-ylpiperidin-1-yl]-(5-thiophen-3-ylpyrazolidin-3-yl)methanone (PubChem CID 133143529) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is [(2R)-2-pyridin-3-ylpiperidin-1-yl]-(5-thiophen-3-ylpyrazolidin-3-yl)methanone.
| Compound Name | [(2R)-2-pyridin-3-ylpiperidin-1-yl]-(5-thiophen-3-ylpyrazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 133143529 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | [(2R)-2-pyridin-3-ylpiperidin-1-yl]-(5-thiophen-3-ylpyrazolidin-3-yl)methanone |
| SMILES | O=C(C1CC(c2ccsc2)NN1)N1CCCC[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C18H22N4OS/c23-18(16-10-15(20-21-16)14-6-9-24-12-14)22-8-2-1-5-17(22)13-4-3-7-19-11-13/h3-4,6-7,9,11-12,15-17,20-21H,1-2,5,8,10H2/t15?,16?,17-/m1/s1 |
| InChIKey | DYYFREPVJYAABS-OFLPRAFFSA-N |
| XLogP | 2.80 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |