C18H27N5O — CID 134127697
(5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-3-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone (PubChem CID 134127697) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is (5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-3-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone.
| Compound Name | (5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-3-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 134127697 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | (5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-3-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone |
| SMILES | CN1CCC2NNC(C(=O)N3CCCCC3c3cccnc3)C2C1 |
| InChI | InChI=1S/C18H27N5O/c1-22-10-7-15-14(12-22)17(21-20-15)18(24)23-9-3-2-6-16(23)13-5-4-8-19-11-13/h4-5,8,11,14-17,20-21H,2-3,6-7,9-10,12H2,1H3 |
| InChIKey | MZEVPCTXUZMHTO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |