C19H27FN4O — CID 78083705
[2-(4-fluorophenyl)piperidin-1-yl]-(5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-3-yl)methanone (PubChem CID 78083705) has the molecular formula C19H27FN4O and a molecular weight of 346.45 g/mol. Its IUPAC name is [2-(4-fluorophenyl)piperidin-1-yl]-(5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-3-yl)methanone.
| Compound Name | [2-(4-fluorophenyl)piperidin-1-yl]-(5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 78083705 |
| Molecular Formula | C19H27FN4O |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | [2-(4-fluorophenyl)piperidin-1-yl]-(5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-3-yl)methanone |
| SMILES | CN1CCC2NNC(C(=O)N3CCCCC3c3ccc(F)cc3)C2C1 |
| InChI | InChI=1S/C19H27FN4O/c1-23-11-9-16-15(12-23)18(22-21-16)19(25)24-10-3-2-4-17(24)13-5-7-14(20)8-6-13/h5-8,15-18,21-22H,2-4,9-12H2,1H3 |
| InChIKey | NTQXPRGJIRECAU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |