C12H15BrO3Zn — CID 133144683
bromozinc(1+);2-[2-(phenoxy)ethyl]-1,3-dioxane (PubChem CID 133144683) has the molecular formula C12H15BrO3Zn and a molecular weight of 352.54 g/mol. Its IUPAC name is bromozinc(1+);2-[2-(phenoxy)ethyl]-1,3-dioxane.
| Compound Name | bromozinc(1+);2-[2-(phenoxy)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 133144683 |
| Molecular Formula | C12H15BrO3Zn |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | bromozinc(1+);2-[2-(phenoxy)ethyl]-1,3-dioxane |
| SMILES | [Zn+]Br.[c-]1ccccc1OCCC1OCCCO1 |
| InChI | InChI=1S/C12H15O3.BrH.Zn/c1-2-5-11(6-3-1)13-10-7-12-14-8-4-9-15-12;;/h1-3,5,12H,4,7-10H2;1H;/q-1;;+2/p-1 |
| InChIKey | CFKVTDGUIKURBF-UHFFFAOYSA-M |
| XLogP | 2.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|