C11H14ClNO2 — CID 133150351
2-(3-chloro-N,4-dimethylanilino)propanoic acid (PubChem CID 133150351) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is 2-(3-chloro-N,4-dimethylanilino)propanoic acid.
| Compound Name | 2-(3-chloro-N,4-dimethylanilino)propanoic acid |
|---|---|
| PubChem CID | 133150351 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-(3-chloro-N,4-dimethylanilino)propanoic acid |
| SMILES | Cc1ccc(N(C)C(C)C(=O)O)cc1Cl |
| InChI | InChI=1S/C11H14ClNO2/c1-7-4-5-9(6-10(7)12)13(3)8(2)11(14)15/h4-6,8H,1-3H3,(H,14,15) |
| InChIKey | PPQQQNLLJGORFS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |